Can someone please help me with this??

Can Someone Please Help Me With This??

Answers

Answer 1
Her rate of speed is 12.075 miles an hour

Related Questions

The matrix A has eigenvalues X₁ = 3 and X₂ = 4 with associated eigenvectors 2 V₁ = and v2 [A] Use this information to find the solution to the initial value - [³] Y' = AY where Y (0) = [ (0)] - [8] - [ 2₂ ] 1 problem = Give your answer as x(t) and y(t). y

Answers

The solution to the initial value problem is:

x(t) = [tex](1/4) * e^{(3t)} - (1/4) * e^{(4t)}[/tex] and y(t) = [tex]e^{(3t)} + (1/6) * e^{(4t)}[/tex]

To find the solution to the initial value problem Y' = AY, where A is the matrix with eigenvalues and eigenvectors given, we can use the eigenvalue-eigenvector method.

Let's denote the eigenvectors as v₁ and v₂:

v₁ = [2]

[8]

v₂ = [-3]

[2]

The general solution to the system of linear differential equations can be written as:

Y(t) = [tex]c_1 * e^{(X_1t)} * v_1 + c_2 * e^{(X_2t)} * v_2[/tex]

where c₁ and c₂ are constants.

Substituting the given eigenvalues and eigenvectors:

Y(t) = c₁ * [tex]e^{(3t)[/tex] * [2] + c₂ * [tex]e^(4t)[/tex] * [-3]

[8] [2]

Simplifying further:

Y(t) = [2c₁ * [tex]e^{(3t)[/tex] - 3c₂ * [tex]e^{(4t)[/tex]]

[8c₁ * [tex]e^{(3t)[/tex] + 2c₂ * [tex]e^{(4t)[/tex]]

To find the specific solution that satisfies the initial condition Y(0) = [0] and [8], we can substitute t = 0 into the general solution:

Y(0) = [2c₁ - 3c₂]

[8c₁ + 2c₂]

Equating this to the initial condition:

[2c₁ - 3c₂] = [0]

[8c₁ + 2c₂] [2]

Solving this system of equations will give us the values of c₁ and c₂:

2c₁ - 3c₂ = 0 ----(1)

8c₁ + 2c₂ = 2 ----(2)

Multiplying equation (1) by 4 and adding it to equation (2), we get:

16c₁ = 2

Solving for c₁, we find:

c₁ = 1/8

Substituting c₁ back into equation (1), we can solve for c₂:

2(1/8) - 3c₂ = 0

1/4 - 3c₂ = 0

3c₂ = 1/4

c₂ = 1/12

Therefore, the specific solution to the initial value problem is:

x(t) = [tex](1/8) * e^{(3t)} * 2 + (1/12) * e^{(4t) }* (-3)[/tex]

y(t) = [tex](1/8) * e^{(3t)} * 8 + (1/12) * e^{(4t)} * 2[/tex]

Simplifying further:

x(t) = [tex](1/4) * e^{(3t)} - (1/4) * e^{(4t)}[/tex]

y(t) = [tex]e^{(3t)} + (1/6) * e^{(4t)}[/tex]

Therefore, the solution to the initial value problem is x(t) = [tex](1/4) * e^{(3t)} - (1/4) * e^{(4t)}[/tex] and y(t) = [tex]e^{(3t)} + (1/6) * e^{(4t)}[/tex].

Learn more about Eigenvectors at

brainly.com/question/31043286

#SPJ4

Can someone explain why the answer is False. Will Mark brainliest.

Answers

Answer:

Supplementary Angles are 180 degrees. A triangle has 180 degrees. One angle is already 90 degrees, so 2 more angles with 180 degrees is impossible.

Step-by-step explanation:

I've done everything I can, please help

Answers

Answer:

D

Step-by-step explanation:

Answer:

4 is choice C. THis is because the y intercept is 1 and when you go up 2 units, and go right once, you go to another point (rise over run)

Step-by-step explanation:

A payment of $970 scheduled to be paid today and a second payment of $1,260 to be paid in seven months from today are to be replaced by a single equivalent payment. What total payment made today would place the payee in the same financial position as the scheduled payments if money can earn 6.25%? (Do not round intermediate calculations and round your final answer to 2 decimal places.)

Answers

Therefore, the total payment made today by the payee is $2,149.01

Payment calculation.

To total payment made today would place the payee in the same financial position as the scheduled payments if money can earn 6.25% we will use the  formula below.

PV = FV /(1 + Rr)^n

r =6.25%

FV = $1,260

PV = $ 1,260 / (1+ 0.0625) ^(7/12)

PV = $ 1,179.01

The value of the second payment is  $ 1,179.01.

Lets find the total payment. We can represent the  total payment by X.

X - $ 970 = $ 1,179.01.

To isolate X, we will add $ 970  to both sides.

X = $ 970 + $ 1,179.01.

X = $2,149.01

Therefore, the total payment made today by the payee is $2,149.01

Learn more about payment below.

https://brainly.com/question/28106777

#SPJ1

40 students where has their favorite shoe color
how many chose blue?

Answers

Answer:

8 students

Step-by-step explanation:

There are 20 boxes and there are a total of 40 students interviewed. So, each box is worth 2 students. Since blue has 4 boxes, 4*2 = 8 students chose blue as their favorite shoe color.

Please mark as Brainliest.

⚡✨

Evaluate the expression when a=-2 and x=6. \

4x-a

Answers

Answer:

26

Step-by-step explanation:

Given

4x - a ← substitute a = - 2, x = 6 into the expression

= 4(6) - (- 2) [ note - (- ) is equivalent to + ]

= 24 + 2

= 26

pythagorean theorem

Answers

Answer:

The pythagorean theorem is a theorem which states that the hypotenuse of a right triangle is equal to the sum of the squares of the other two sides.

Pythagorean theorem

in the right angle triangles there is a relationship that governs the length of the three sides. if we knows the length of any two sides, the third side may be calculated by the use of the Pythagorean theorem.

This theorem states that the square on the hypotenuse of a right angled triangle is equal to the sum of the squares on the remaining two sides.

we only use Pythagorean theorem to find the length of the missing side of a right angled triangle only.

Algebra pls help

Really

Answers

Answer: n=-14

Step-by-step explanation:

CONCEPT:

When the same-base exponents MULTIPLY= adding the exponents When the same-base exponents DIVIDE= subtracting the exponents

SOLVE:

The expression in the questions is [tex](x^{3} )(x^{-17})[/tex] which is MULTIPLYING, which means we should add the exponents together

[tex](x^{3} )(x^{-17})[/tex]=[tex]x^n[/tex] ⇔ Given

[tex]x^{3+(-17)}[/tex]=[tex]x^n[/tex] ⇔ Adding Exponents Together

[tex]x^{3-17}[/tex]=[tex]x^n[/tex] ⇔ Simplify

[tex]x^{-14}[/tex]=[tex]x^n[/tex] ⇔ Simplify

[tex]n[/tex]=[tex]-14[/tex] ⇔ Correspondingly

Hope this helps!! :)

Please let me know if you have any questions

A steam power plant operates on the ideal reheat-pipe steam Rankine cycle and generates 90 MW of net power. Steam enters the high pressure turbine at a pressure of 10 MPa and a temperature of 520° and exits at a pressure of 1 MPa. Some steam leaving the turbine at this pressure is used to heat the boiler feedwater in an open feedwater heater. After the remaining steam is heated to 480°, it is expanded in the low pressure turbine to a condenser pressure of 14 kPa. Calculate the mass flow rate of the steam passing through the boiler and the thermal efficiency of the cycle by showing the cycle in a T-s diagram with saturated liquid and saturated steam curves.

Answers

The mass flow rate is 0.56 kg/s

How to determine the mass flow rate

The formula for calculating the mass flow rate is expressed as;

m = W / (hf - hg)

Such that the parameters are expressed as;

m is the mass flow rate (kg/s)W is the net power output (W)hf is the enthalpy of the feedwater (kJ/kg)hg is the enthalpy of the steam at the turbine exit (kJ/kg)

Substitute the values, we get;

m = 90 MW / (2418 - 2257)

Subtract the values, we have;

m = 90/161

Divide the values, we get;

m=  0.56 kg/s

Learn more about mass flow rate at: https://brainly.com/question/30618961

#SPJ4

Karlyn had an online business selling earrings. The materials to make a pair of earrings cost $15.00. Since it took her an hour to make each pair of earrings, she wanted to markup the price by $35 for her time and sell them for $50.00. What is the % markup for that pair of earrings?

Answers

The markup would be 133.33%

30is 200% of 15

5 is 33.33333333% of 15

33.33333333%+100+=133.33333333%

The markup is 133.33% or 133.33333333%

Are these proportional?
6/9 and 2/3

Answers

Answer:

yes.

Step-by-step explanation:

Ratios are proportional if they represent the same relationship. One way to see if two ratios are proportional is to write them as fractions and then reduce them. If the reduced fractions are the same, your ratios are proportional.

6/9 divided by 3/3= 2/3

proportional

HELP ME PLEASEEEEEEE CIRCUMFERENCE AND AREA OF A CIRCLE

Answers

Answer:

Formula for circumference: 2 x pie(3.14 or 22/7) x radius(half of diameter or already given radius). Area of a circle: pie(3.14 or 22/7) x radius squared

Radius: 3, 6 is diameter and half of that is 3.

3 x 3.14 x 2 = 18.84 <------ circumference

3.14 x 3^2

3.14 x 9 = 28.26 <------ area of the circle

please helpppp
also just click the image for it to be bigger

Answers

The third one: y=-3/4x+6

A survey​ asked, "How many tattoos do you currently have on your​ body?" Of the 1233 males​ surveyed, 190 responded that they had at least one tattoo. Of the 1033 females​ surveyed,128

responded that they had at least one tattoo. Construct a 99​% confidence interval to judge whether the proportion of males that have at least one tattoo differs significantly from the proportion of females that have at least one tattoo. Interpret the interval.

Let p1 represent the proportion of males with tattoos and p2 represent the proportion of females with tattoos. Find the 99​% confidence interval for p1−p2.

The lower bound ___ your response here.

The upper bound is ___ ​(Round to three decimal places as​ needed.)

Interpret the interval.

A.There is 99​% confidence that the difference of the proportions is in the interval. Conclude that there is insufficient evidence of a significant difference in the proportion of males and females that have at least one tattoo.

B.There is a 99​% probability that the difference of the proportions is in the interval. Conclude that there is insufficient evidence of a significant difference in the proportion of males and females that have at least one tattoo.

C.There is a 99​% probability that the difference of the proportions is in the interval. Conclude that there is a significant difference in the proportion of males and females that have at least one tattoo.

D.There is 99​% confidence that the difference of the proportions is in the interval. Conclude that there is a significant difference in the proportion of males and females that have at least one tattoo.

Answers

There is insufficient evidence of a significant difference in the proportion of males and females that have at least one tattoo.

Therefore, the correct answer is A.

To construct a confidence interval for the difference in proportions, we can use the following formula:

CI = (p1 - p2) ± Z ×√[(p1×(1 - p1) / n1) + (p2 × (1 - p2) / n2)]

Where:

p1 and p2 are the sample proportions for males and females, respectively.

n1 and n2 are the sample sizes for males and females, respectively.

Z is the critical value corresponding to the desired confidence level.

From the given information, we have:

p1 = 190/1233

n1 = 1233

p2 = 128/1033

n2 = 1033

Confidence level = 99% (which corresponds to a critical value of Z)

Calculating the confidence interval:

CI = (190/1233 - 128/1033) ± Z× √[(190/1233× (1 - 190/1233) / 1233) + (128/1033 ×(1 - 128/1033) / 1033)]

Now, let's find the critical value Z for a 99% confidence level. Since the sample sizes are large, we can use the standard normal distribution. The critical value for a 99% confidence level is approximately 2.576.

CI = (0.154 - 0.124) ± 2.576× √[(0.154× (1 - 0.154) / 1233) + (0.124 × (1 - 0.124) / 1033)]

CI = 0.030 ± 2.576×√[0.000118 + 0.000124]

CI = 0.030 ± 2.576×√(0.000242)

CI = 0.030 ± 2.576×0.015556

CI = 0.030 ± 0.040085

CI ≈ (-0.010, 0.070)

The lower bound of the 99% confidence interval is approximately -0.010, and the upper bound is approximately 0.070.

Interpreting the interval, we can say:

A. There is 99% confidence that the difference of the proportions is in the interval. Conclude that there is insufficient evidence of a significant difference in the proportion of males and females that have at least one tattoo.

Therefore, the correct answer is A.

Learn more about standard normal distribution here:

https://brainly.com/question/31379967

#SPJ11

plz help me please please​

Answers

Answer:

5%

Step-by-step explanation:

Answer:

5% increase

Step-by-step explanation:

30/600 equals .05 or 5%

Find mZN.
62°
K
N
Need help with this question?

Answers

Answer:

118degrees

Step-by-step explanation:

Assuming we are given the following and m<k and ,<N lies on the same straight line, hence;

m<K = 62 degrees

n<N = ?

Since are on the same straight line, hence;

m<N + m<K = 180

m<N + 62 = 180

m<N = 180 - 62

m<N  = 118

Hence the measure of m<N is 118degrees

'

,

Factor the expression over the complex numbers. x2+20 Enter your answer in the box.

Answers

Answer:

2(x plus 20)

Step-by-step explanation:

this is the highest common factor

What is the value of x?

Answers

Answer:

106

Step-by-step explanation:

reflection

Translate each equation into slope-intercept form. Then, state the slope and y-intercept . 4y=2x+20

Answers

Answer:

           The slope-intercept form of the equation:  y = 0.5x + 5

           The slope:    m = 0.5

           The y-intercept:     b = 5

Step-by-step explanation:

Slope-intercept form is  y = mx + b, where m is the slope and b is y-intecept

4y = 2x + 20           {divide both sides by 4}

y = 0.5x + 5   ⇒   m = 0.5  and  b = 5

Let f(x) E Z[x] with deg (f(x)) ≥ 1, and let f(x) be the polynomial in Z, [x], where p is prime integer, obtained from f(x) by reducing all the coefficients of f(x) modulo p. Assume that deg (F(x)) = deg(f(x)), then: If f(x) is reducible over Q. then f(x) is irreducible over Z O This option If f(x) is reducible over Zp, then f(x) is reducible over Q If f(x) is reducible over Zp, then f(x) is reducible over Q O This option None of choices

Answers

If f(x) is reducible over Zp, then f(x) is reducible over Q.

What is the probability of selecting a respondent who prefers public transportation or cycling from a survey of 500 commuters?

If a polynomial f(x) with integer coefficients is reducible over Zp (the integers modulo p), where p is a prime number, then it is also reducible over Q (the rational numbers).

This result follows from the fact that if a polynomial is reducible over a smaller field (Zp), it must also be reducible over a larger field (Q).

Since Zp is a subset of Q, any factorization of the polynomial in Zp can also be used in Q. Therefore, if f(x) is reducible over Zp, it is also reducible over Q.

Learn more about reducible over

brainly.com/question/317820

#SPJ11

0
Tickets to a movie cost $9.00 for adults and $5.50 for students. There were 150 tickets purchased for a total of $1,105.00. The following system of
equations models the situation, where a is the number of adult tickets purchased and s is the number of student tickets purchased. Write the
terms with the variables in alphabetical order.
9a + 5.5s = 1.105
a +5 = 150
Rewrite the second equation in the system so that the variable for the number of adult tickets purchased can be eliminated by subtraction.

Answers

Answer:

150a

Step-by-step explanation:

Which decimal is closest in value to the fraction below? 1/6


Answers

Answer:

0.1666...

Step by step explanation:

By using long division (with 6 as the divisor) the number sentence would keep on going with 40-36.

0.166666666

1.000000000

− 0                  

 10                

−  6                

  40              

 −36              

   40            

   −36            

       40          

     − 36          

         40        

       − 36        

           40      

         − 36      

             40    

           − 36    

               40  

             − 36  

                 40

               − 36

Last year the records of a convenience store chain showed the mean amount spent by a customer was $52. A sample of 36 transactions made this month revealed the mean amount spent was $50 with a standard deviation of $11. At the 0.10 significance level, test the claim that the mean amount spent by a customer has significantly decreased since last year.

Answers

There insufficient evidence to support the claim that the mean amount spent by a customer has significantly decreased since last year.

Step 1: State the hypotheses:

- Null hypothesis (H0): The mean amount spent by a customer is equal to or greater than last year's mean ($52).

- Alternative hypothesis (H1): The mean amount spent by a customer is significantly less than last year's mean ($52).

Step 2: Set the significance level:

The significance level (α) is given as 0.10. This represents a 10% chance of rejecting the null hypothesis when it is true.

Step 3: Formulate the decision rule:

Since the alternative hypothesis is stating a decrease in the mean amount spent, we will conduct a one-tailed t-test and reject the null hypothesis if the test statistic falls in the critical region corresponding to the left tail of the t-distribution.

Step 4: Calculate the test statistic:

We need to calculate the t-statistic using the formula:

t = (sample mean - population mean) / (sample standard deviation / √(sample size))

Given data:

Population mean (μ) = $52

Sample mean (X) = $50

Sample standard deviation (s) = $11

Sample size (n) = 36

Plugging in the values:

t = ($50 - $52) / ($11 / √(36))

t = -2 / ($11 / 6)

t ≈ -1.0909

Step 5: Determine the critical value and make a decision:

Since the significance level is 0.10 and the test is one-tailed to the left, we need to find the critical t-value at a 0.10 significance level with degrees of freedom equal to (n - 1) = (36 - 1) = 35.

so, the critical t-value is -1.3104.

Since the calculated t-statistic (-1.0909) does not fall in the critical region (t < -1.3104), we do not have enough evidence to reject the null hypothesis.

Step 6: State the conclusion:

Based on the data and the hypothesis test, at the 0.10 significance level, there is insufficient evidence to support the claim that the mean amount spent by a customer has significantly decreased since last year.

Learn more about Hypothesis Test here:

brainly.com/question/24224582

#SPJ4

A size 8 kid's shoe measures 9 2/3 inches. If 5 size 8 shoes are lined end to end, then how many inches will they cover?

Answers

Answer:

its 77 1/3

just do the math with a calculator

Answer: 48 1/3

Step-by-step explanation:

Which of the graphs below represents the soltuion set for d - 4 > -3?

Answers

Answer:

The answer is d

Step-by-step explanation:

Now, the Group of Good would like to decide how they should infiltrate the gallery. The group wants to vote on different plans to sneak into the gallery; the plans are labelled a - e. While the group puts all of the plans together so everyone can see them, a tragedy occurs. Kenny gets a paper cut by Plan a! The cut is too deep! Saddened by their colleague’s sudden paper death, they decide that the leader should have more say in which plan is picked (in hopes to avoid more unnecessary death). Suppose the leader’s vote (from the last question) counts as 5 votes. The following preference schedule is produced:

Total Votes = 2 2 1 1

Choice 1 e c a b b

Choice 2 d a b d a

Choice 3 c d e c d

Choice 4 a b d e c

Choice 5 b e c a e

(a) If plurality voting is used, what plan should the group use? Does this plan have a majority

Total Votes = 2 2 1 1

Choice 1 e c a b b

Choice 2 d a b d a

Choice 3 c d e c d

Choice 4 a b d e c

Choice 5 b e c a e

(b) If Instant Runoff Voting is used, what plan should the group use? Show how you discovered your answer.

Total Votes = 2 2 1 1

Choice 1 e c a b b

Choice 2 d a b d a

Choice 3 c d e c d

Choice 4 a b d e c

Choice 5 b e c a e

(c)If the Borda Count method is used, what plan should the group use? Show how the winner is computed

What was the best part of this project? What was the worst part?

Answers

(a) If plurality voting is used, Plan E will be chosen.

b It has the most first-place votes, with 2 each from voters 1 and 5. No other plan has more than 1 first-place vote.

c If the Borda Count method is used, Plan C will be chosen.

How to explain the information

a The best part of this project was learning about different voting methods and how they can be used to choose a winner. The worst part of the project was the difficulty of calculating the Borda Count.

b If Instant Runoff Voting is used, Plan C will be chosen. In the first round of counting, Plan E is eliminated, as it has the fewest first-place votes. In the second round, Plan C is eliminated, as it has the fewest second-place votes. In the third round, Plan B is eliminated, as it has the fewest third-place votes. In the fourth round, Plan D is eliminated, as it has the fewest fourth-place votes. This leaves Plan A as the winner, as it has the most votes remaining.

c If the Borda Count method is used, Plan C will be chosen. Each voter's ballot is assigned a number of points equal to the number of candidates ranked lower than that candidate. For example, voter 1's ballot gives Plan E 5 points, Plan C 4 points, Plan A 3 points, Plan B 2 points, and Plan D 1 point. The total number of points for each candidate is then calculated. Plan C has the most points, with 16, so it is the winner.

Learn more about plurality on

https://brainly.com/question/14581557

#SPJ4

Please help!!! I’ll mark you as brainliest!!!!!!

0.138613961 as a percent rounded to the nearest tenth

Answers

Answer:

13.9% Approximately

the radius of a circle is 18.4 inches. the circle's circumference is about ___ inches.

use 3.14 for pi

Answers

Answer:

115.552 or 116 inches.

Step-by-step explanation:

Use the circumference of a circle formula which is C= 2piR. Where C is circumference and R is radius. So you get C=2(3.14×18.4) which gives you 115.552.

Given the points P(0,0,-2), Q(2,3,4), R(4, 6, 5), and S(6, 11, 10), find the following: (a) The area of triangle PQR. (b) An equation of the form ax + by + cz = d for the plane containing points P, Q, and R. (c) The volume of the parallelepiped with edges PO.PR, and Ps. (d) A point on the line through P and Q which is two units away from P.

Answers

(a) The area of triangle PQR is 9.165 units².

(b) The formula for a plane given three points is: 10x - 7y - 2z = 0

(c) The volume of the parallelepiped with edges PO, PR, and PS is 148 units³.

(d)  A point on the line through P and Q which is two units away from P is (4/5, 6/5, 2/5).

(a) The area of triangle PQR is 9.165 units².


The formula for the area of a triangle given three points is:

Area = 1/2 | ((x2 − x1) × (y3 − y1)) − ((y2 − y1) × (x3 − x1)) |

The coordinates for P, Q, and R are: P (0, 0, -2)Q (2, 3, 4)R (4, 6, 5)

Substituting into the formula gives us:

Area = 1/2 | ((2 - 0) × (5 + 2)) − ((3 - 0) × (4 - 0)) |

Area = 9.165 units² (rounded to three decimal places)



(b) An equation of the form ax + by + cz = d for the plane containing points P, Q, and R is:

10x - 7y - 2z = 0

The formula for a plane given three points is: ax + by + cz = d

To find a, b, c, and d, we first need to find two vectors on the plane.

We can use PQ and PR.

PQ = Q - P = (2 - 0)i + (3 - 0)j + (4 + 2)k = 2i + 3j + 6k

PR = R - P = (4 - 0)i + (6 - 0)j + (5 + 2)k = 4i + 6j + 7k

Now we can find the normal vector by taking the cross product of PQ and PR:

PQ x PR = <3i - 26j - 12k>

So the equation of the plane is:3x - 26y - 12z = 0

We can simplify this by multiplying all terms by -2, which gives:10x - 7y - 2z = 0



(c) The volume of the parallelepiped with edges PO, PR, and PS is 148 units³.

The volume of a parallelepiped is given by the scalar triple product of three vectors.

We can use OP, PR, and PS.

OP = P - O = -i - j - 2k = < -1, -1, -2 >

PR = R - P = 4i + 6j + 7k = < 4, 6, 7 >

PS = S - P = 6i + 11j + 12k = < 6, 11, 12 >

The scalar triple product is:

OP ⋅ (PR x PS)OP ⋅ (PR x PS) = < -1, -1, -2 > ⋅ (< 54, -20, -10 >)OP ⋅ (PR x PS) = -148

The volume of the parallelepiped is 148 units³.



(d) A point on the line through P and Q which is two units away from P is (4/5, 6/5, 2/5).

The equation of the line through P and Q is:x = 2t, y = 3t, z = 4 + 6t

A point on the line that is two units away from P is given by:

t = 2/5

Substituting into the equations for x, y, and z gives:(4/5, 6/5, 2/5)

To learn more about parallelepiped

https://brainly.com/question/30652871

#SPJ11

write rational number in number line -7 upon 2​

Answers

Answer:

el numero 1

Step-by-step explanation:

Other Questions
Suppose the prevalence of is 12.5%. We assume thediagnostic test has a sensitivity of 80% and a95% specificity. What is the probability of getting a negativeresult? Which of the following combinations of bends can be used in a conduit run?A. One 90-degree, three 45-degree, and four 30-degreeB. TWO 90-degree, two 45-degree, and four 30-degreeC. Two 90-degree, four 45-degree, and one 30-degreeD. One 90-degree, six 45-degree, and one 30-degree Write the Kb expression for the reaction of propylamine, C3H7NH2 with water.a. [C3H7NH+3][OH][C3H7NH2]b. [C3H7NH2][H2O][C3H7NH+3][OH]c. [C3H7NH2][C3H7NH+3][OH]d. [C3H7NH+3][OH][C3H7NH2][H2O] preparing a given volume of a solution that has a specific molarity is a very important skill for a chemist. one step in that process is calculating the mass of solute required.What mass of solute is required to produce 429.5 mL of a 0.256 M solution of KBr? _______ g KBr HELP NOW!!! 100 POINTS! Cylinder A has a radius of 10 inches and a height of 5 inches. Cylinder B has a volume of 750. What is the percentage change in volume from cylinder A to cylinder B? 50% decrease 75% decrease 50% increase 200% increase Imagine yourself at the top management level of a business. Considering the authority and power of the top management, which of the Scientific Management Approaches would you prefer to apply for the business activities? Discuss the reasons. According to the Real Business Cycle, an increase in government spending: Increases output without any effect on price Increases price without any effect on output O Increases both price and output O Shifts the long-run supply to the right Which verb pair correctly completes this sentence? In circle O, radius OQ measures 9 inches and arc PQ measures 6 inches. Circle O is shown. Line segments P O and Q O are radii with length of 9 inches. Angle P O Q is theta. What is the measure, in radians, of central angle POQ? StartFraction 2 pi Over 3 EndFraction radians StartFraction 3 pi Over 4 EndFraction centimeters StartFraction 4 pi Over 3 EndFraction radians StartFraction 3 pi Over 2 EndFraction radians -9=k/6-8can anyone help please. An observation has a studentized residual of 1.478 and a leverage value of 0.364. Find the DFITS for the observation. A brewery produces a particular type of beer. If the process is running well then the probability that a randomly selected bottle is of good quality is 90%, independently of the quality of any of the other bottles. If the process is not running well then that probability is only 60%. Without further information, the probability that the process is running well is 80%. (a) 10 bottles are produced. Find the expected number of good quality bottles in this batch. (b) of this batch, the first 4 bottles are tested, and all are of good quality except for the second bottle. What is the probability that the process is running well? (c) The 5th bottle is now tested as well. What is the probability that this bottle is of good quality? HELPPPPPPPPPPPPPPPP FAST Type the correct answer in the box. Spell all words correctlyWhile moving data into a data warehouse, Ivan and his team discover duplicate records in the transactional database. Which process in thestaging area is responsible for removing these duplicate records?The data ______process removes the duplicate data in the staging area. MAFS.4.0A.1.22. Eddie has 50 marbles. Manny has m marbles. If Eddiehas 10 times as many marbles as Manny, write anequation that shows how many marbles Manny has. Find the area of the figure. Help plssss I need to find mr pryor account balance 4 Does the equation y = x represent a function? Explain why or why not. 5. The owners of a two-person business make their decisions independently of each other and then compare their decisions. If they agree, the decision is made; if they do not agree, then further consideration is necessary before a decision is reached. The first owner makes the right decision 60% of the time; the second - 70% of the time. Enter your answers as decimals. 5(a) What is the probability that they make the right decision on the first try. 5(b) What is the probability that they make the wrong decision on the first try. 5(c) What is the probability that they delay the decision for further study. The U.S. Declaration of Independence and the French Declaration of the Rights ofMan and Citizen reflect a shared concern for-