Drag each tile to the correct box.
Match each equation with its solution.





Equation
Solution

arrowRight

arrowRight

arrowRight

arrowRight

Answers

Answer 1

The correct match of each tile of the equation with its solution is:

n - 13 = - 12 →→→ 1n/5 = -1/5  →→→ -1n + 15 = - 10 →→→ -25

How do we match each tile to the correct box?

To match each tile to the correct box, we have to solve the arithmetic operations in the box, then drag the correct tile that matches our answer into the box.

From the image attached below;

1.

n - 13 = - 12

Let us add (+13) to both sides to eliminate (-13), i.e.

n - 13 + 13 = - 12 + 13

n = 1

2.

n/5 = -1/5  

multiply both side by 5

n/5 × (5) = -1/5 × (5)

n = -1

3.

n + 15 = - 10

n +15 - 15 = - 10 - 15

n = -25

Learn more about matching each tile to the correct box here:

https://brainly.com/question/17203448

#SPJ1

Drag Each Tile To The Correct Box.Match Each Equation With Its Solution.EquationSolutionarrowRightarrowRightarrowRightarrowRight

Related Questions

e^(3x)+e^x-6=0

stuck on step u = e^x, u^3 + u - 6 = 0

Answers

The Solution to the given equation is gotten as; x = 0.4913

How to solve differential equations?

We are given the equation;

e³ˣ + eˣ - 6 = 0

Let u = eˣ. Thus, our equation is now;

u³ + u - 6 = 0

Factorizing this to find the roots gives us;

u = 1.6344

Thus;

eˣ = 1.6344

x = In 1.6344

x = 0.4913

Read more about Differential Equations at; https://brainly.com/question/18760518

#SPJ1

For the complex number z = (5sqrt(3))/4 - 5/4 * i what is the polar form

Answers

The complex number in rectangular form z = (5√3 / 4) - i 5/4 is equivalent to the complex number in polar form z = 5/2 · (cos 11π/6 + i sin 11π/6). (Correct choice: C)

How to transform a complex number in rectangular form into polar form

Complex numbers are elements of the form z = a + i b, where [tex]a, b \in \mathbb{R}[/tex]. In other words, represents a generalization from real numbers. The polar form of a complex number is shown below:

[tex]z = r\cdot (\cos \theta + i \,\sin \theta)[/tex]     (1)

Where:

r - Normθ - Direction, in radians.

The norm is determined by Pythagorean theorem and the direction by inverse trigonometric reason. If we know that z = (5√3 / 4) - i 5/4, then its polar form is shown below:

Norm

[tex]r = \sqrt{\left(\frac{5\sqrt{3}}{4} \right)^{2}+\left(-\frac{5}{4} \right)^{2}}[/tex]

r = 5/2

Direction

[tex]\theta = \tan^{-1} \left[\frac{\left(-\frac{5}{4} \right)}{\left(\frac{5\sqrt{3}}{4} \right)} \right][/tex]

θ = 11π/6 rad

Thus, the complex number in rectangular form z = (5√3 / 4) - i 5/4 is equivalent to the complex number in polar form z = 5/2 · (cos 11π/6 + i sin 11π/6).

To learn more on complex numbers: https://brainly.com/question/10251853

#SPJ1

Find the value of 8power of five

Answers

Answer:

the answer is 32,768 hopes this helps

Step-by-step explanation:

8^5 = 8x8x8x8x8 = 64x8x8x8= 64x64x8 = 4096x8= 32,768

Slope of (1,-4) and (0,-5)

Answers

Answer:

Slope is 1

Step-by-step explanation:

use slope formula: m= [tex]\frac{y2-y1}{x2-x1}[/tex]

m= [tex]\frac{-5+4}{0-1}[/tex]

[tex]\frac{-1}{-1}=1[/tex]

m=1

Hope this helps!

If not, I am sorry.

Hi student, let me help you out! :)

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

We are asked to find the slope of

[tex]\star\mathrm{(1,-4)}[/tex]

[tex]\star\mathrm{(0,-5)}[/tex].

[tex]\triangle~\fbox{\bf{KEY:}}[/tex]

Use the slope formula.

Here's the slope formula:

[tex]\star\boxed{\mathrm{\cfrac{y2-y1}{x2-x1}}}[/tex]

Input the values, which are:

y2=-5

y1=-4

x2=0

x1=1

[tex]\star\mathrm{\cfrac{-5-(-4)}{0-1}}[/tex]

Simplify!

[tex]\star\mathrm{\cfrac{-5+4}{-1}}[/tex]

[tex]\star\mathrm{\cfrac{-1}{-1}}[/tex]

[tex]\star\boxed{\mathrm{1}}[/tex]

Hope it helps you out! :D

Ask in comments if any queries arise.

#StudyWithBrainly

~Just a smiley person helping fellow students :)

[tex]\bf{\overline{\underline{\overline{\underline{Maribel\:Peri}}}}[/tex]

If Sammy starts drinking his tea at 11:25 P.M. and he finishes it at 12:20 A.M., how long does it take him to drink his tea?

Answers

Answer:

55 minutes

Step-by-step explanation:

add 35 to 11:25 should equal to 12AM then add 20 to it should give you the answer of 12:20AM combining the 35 and 20 should give you 55

Answer:

55 Minutes

Step-by-step explanation:

Assuming the start time is on the previous day, the time between 11:25:00 PM and 12:20:00 AM is:

0 hour, 55 minutes, and 0 second

0.917 hour

55 minutes

3,300 seconds

Hope this helps!

Condense the expression to the logarithm of a single quantity.


I'm going to be so thankful if anyone could solve this for me please... because I can't understand any of it right now.​

Answers

[tex]\dfrac 12 \log_3 x - 2\log_3 (y +8)\\ \\=\log_3 x^{\tfrac 12}- \log_3(y+8)^2~~~~~~~~~~~~~~~~~~;[\log_b m^n = n \log_b m]\\\\=\log_3 \left( \dfrac {x^{\tfrac 12}}{y+8)^2} \right)~~~~~~~~~~~~~~~~~~~~~~~~;\left[\log_b \left( \dfrac mn \right) = \log_b m - \log_b n \right][/tex]

A larger error variance makes it difficult to estimate the partial effect of any of the independent variables on the dependent variable. a. True b. False

Answers

A larger error variance making it difficult to estimate the partial effect of any of the independent variables on the dependent variable is True.

What is Variance?

This is used to measure how far a data is spread out and the effect independent variables has on the dependent ones.

When there is an error in the variance, the effect calculated is inaccurate which brings about difficulty in ascertaining it.

Read more about Variance here https://brainly.com/question/15707019

#SPJ1

Consider this sphere with a diameter of 12 cm. a sphere with diameter 12 centimeters. what is the volume of the sphere? sphere v = four-thirds pi r cubed 24pi cm3 48pi cm3 288pi cm3 2,304pi cm3

Answers

V=4/3*pi*6^2=48pi cm^3

Answer: 200 pi

Step-by-step explanation:

if a= 2x - 3 and b= 2x+5
find the value of a+b
help pleaseeee i would really appreciate

Answers

Answer:

4x+2

Step-by-step explanation:

a= 2x - 3 and b= 2x+5

a+b = 2x-3 + 2x+5

Combine like terms

a+b = 4x+2

Answer:

a + b = 4x + 2

Step-by-step explanation:

a = 2x - 3

b = 2x + 5

a + b = (2x-3) + (2x+5)

a + b = 2x + 2x - 3 + 5

a + v = 4x + 2

If f(x)=3x+5/x, what is f(a + 2)?

a. 3a + 5/a + 2

b. 3(f(a)) + 5/f(a)+2

c. 3(a+2) + 5/a+2

Answers

Answer:

Answer C is correct

Step-by-step explanation:

1. We replace x as (a + 2)

2. Then we just rewrite this function with the new value

3. Result: 3(a+2) + 5/(a+2)

Jill jogs 3/4 of a mile in 1/10 of an hour at this rate how fast does she run one mile.

10 minutes
6 minutes
8 minutes

Answers

Answer:

8 minutes

Step-by-step explanation:

Jill jogs 3/4 of a mile in 1/10 hour.

⇒ 3/4 of a mile takes 6 minutes

For one mile :

3/4 mile x 4/3 : 6 x 4/3 minutes1 mile : 2 x 4 minutes1 mile takes 8 minutes
3/4 mile she ran in 1/10hour

1 mile she can run

1/10÷3/44/3(1/10)4/302/15hour8/60hour

8 mins

4x what = 364

please put the calculation

Answers

Answer:

91

Step-by-step explanation:

4 x 91 = 364

To work this out, we must do the inverse operation. The inverse (opposite) of x (times or multiply) is ÷ (divide).

So, we do 364 ÷ 4 = 91

Hope this helps!

- profparis

11. Courtney removes a colored tile from a bag containing 12 red tiles, 10 blue tiles, and
8 yellow tiles. Without replacing the first tile, she removes a second tile from the bag.
What is the probability that both tiles that Courtney removed are blue? Identify
whether removing the second tile from the bag is an independent event of a
dependent event. Justify your response.

Answers

Answer:

whos courtney

Step-by-step explanation:

whos courtney??

Translate the shape A two squares right and one square up.What are the coordinates of the vertices of the image?

Answers

Answer:

(3, 5) (3, 2) , (5, 2)

Step-by-step explanation:

Analysis:

(1) Translate square A two squares right

(a, b) ⇒ ( a + 2, b)

{ (1, 4)          {(3, 4)

{ (1, 1)   ⇒   { (3, 1)

{ (3, 1)         {  (5, 1)

(2) ... one square up:

(a, b) ⇒ (a, b + 1)

{ (3, 4)           { (3, 5)

{ (3, 1)    ⇒    {  (3, 2)

{   (5, 1)       {      (5, 2)

Which matrix multiplication is possible?

Answers

Answer:

second 0ne

Step-by-step explanation:

3×-1+-2 ×0

3×0+-2×3

Which statement is true?
A Two points can be noncollinear.
B Any two points can be noncoplanar.
C Any two points are sufficient to determine a line.
D Two points are sufficient to determine a plane.

Answers

Answer:

C is true as 2 pionts = a line

Step-by-step explanation:

I'm smartest in my class

Find f(2) if f(x)= (x +1)^2

Answers

Answer:

9

Step-by-step explanation:

substitute the x which is x= 2, so

f(2)= (2+1)^2

=(3)^2

=9

Answer:

9

Step-by-step explanation:

WILL GIVE BRAINLIST

Tamara found that as she increased the amount of chlorine in her pool, the amount of mold in the pool decreased. What is the correlation?​

Answers

Answer:

Step-by-step explanation:

Find out the  how much chlorine is in the pool .

To prove

As given

The amount of chlorine in a swimming pool varies directly with the volume of water.

The pool has 2.5 milligrams of chlorine per liter of water.

i.e

2.5 milligrams of chorine = 1 litre of water

There are 8000 gallons of water in the swimming pool.

As 1 gallons = 3.78541 litre (Approx)

Now convert 8000 gallons of water in litres.

8000 gallons = 8000 × 3.78541 litre

                     = 30283.28 litres

Now calculate chlorine in the pool for 30283.28 litres  of waters.

As

2.5 milligrams of chlorine = 1 litre of water

2.5 × 30283.28 milligrams of chlorine = 30283.28 litre of water

75708.2 milligrams of chlorine for 30283.28 litre of water .

Answer:

Negative correlation

Step-by-step explanation:

As one value increases when the other one decreases, we can say the correlation is a negative correlation.

3. How many solutions does the equation have?
−8x+6+20x = 2/3(18x + 9)
O No Solutions
○ Two Solutions
O One Solution
An infinite number of solutions

Answers

An infinite number of solutions since the right side is equal the left side for every value of x.

The tables show linear functions representing the estimated time it takes for the math and language arts portions of standardized tests with different numbers of questions. Which function has the greater slope and what does it indicate? The math function has the greater slope, which shows that the estimated time per question for math is less than the estimated time per question for language arts. The math function has the greater slope, which shows that the estimated time per question for math is greater than the estimated time per question for language arts. The language arts function has the greater slope, which shows that the estimated time per question for language arts is less than the estimated time per question for math. The language arts function has the greater slope, which shows that the estimated time per question for language arts is greater than the estimated time per question for math.

Answers

The language arts function has the greater slope. Then the correct option is C.

What is the linear system?

A linear system is one in which the parameter in the equation has a degree of one. It might have one, two, or even more variables.

The tables show linear functions representing the estimated time it takes for the math and language arts portions of standardized tests with different numbers of questions.

The table is shown below.

The slope of math will be

Slope of math = (207 - 87)/ (65 - 25)

Slope of math = 120/40

Slope of math = 3

The slope of language arts will be

Slope of language arts = (248 - 88)/(60 - 20)

Slope of language arts = 160/40

Slope of language arts = 4

The language arts function has the greater slope, which shows that the estimated time per question for language arts is less than the estimated time per question for math.

More about the linear system link is given below.

https://brainly.com/question/20379472

#SPJ1

Answer:D-The language arts function has the greater slope, which shows that the estimated time per question for language arts is greater than the estimated time per question for math.

Step-by-step explanation:

Q). Express each of the following recurring decimal as a rational numbers . 1) 0.5 2) 0.13 3) 0.341​

Answers

The following recurring decimal as a rational number are 1/2, 13/100 and 341 / 1000

What is rational number?

A rational number is a number that is expressed as the quotient or fraction of two integers, a numerator and a non-zero denominator such as;

3/4. where,

Numerator = 3Denominator = 4

Therefore,

0.5

= 5/10

= 1/2

0.13

= 13/100

0.341

= 341 / 1000

Learn more about rational number:

https://brainly.com/question/12088221

#SPJ1

Karen needs to make a total of 60 deliveries this week. So far she has completed 33 of them What percentage of her total deliveries has Karen completed?

Answers

Answer:

55%

Step-by-step explanation:

(33/60) * 100

leave a comment if u need further explanation

4 cups is equivalent to ____ quart

Answers

Answer:

1 quart is equal to 4 cups

Step-by-step explanation:

4 cups is equivalent to __1__ quart

Find the difference or type
"impossible"

Answers

Answer:

hope you can understand

Are you good at maths?????????????????????????

Answers

The probability that a student, chosen at random, does not study chemistry is 20/41.

What is Probability?

Probability can be defined as the ratio of the number of favorable outcomes to the total number of outcomes of an event. For an experiment having 'n' number of outcomes, the number of favorable outcomes can be denoted by x. The formula to calculate the probability of an event is as follows.

Probability(Event) = Favorable Outcomes/Total Outcomes = x/n

Here, Total number of student = 41

         Student who does not study chemistry = 20

So, the probability = favorable outcome / total outcomes

             P(not studying chemistry) = 20 / 41

Thus, The probability that a student, chosen at random, does not study chemistry is 20/41.

Learn more about Probability from:

https://brainly.com/question/11234923

#SPJ1

Need the correct answers to select asap! Will give brainliest for correct answers

Answers

Answer:

first 2 options and 5th option are true

Step-by-step explanation:

locate y = - 4 on the y- axis. then a horizontal line through y = - 4 intersects the curve at x = - 2 and x = 1

----------------------------------------------------------

the axis of symmetry is a vertical line through the vertex with equation

x = c ( c is the value of the x- coordinate of the vertex )

vertex = ( - [tex]\frac{1}{2}[/tex], - 6 )

equation of axis of symmetry is x = - [tex]\frac{1}{2}[/tex]

------------------------------------------------------------

the minimum value is the y- coordinate of the vertex

that is the minimum value of f(x) is - 6

------------------------------------------------------------

given a parabola in standard form

ax² + bx + c ( a ≠ 0 )

• if a > 0 then graph opens up

• if a < 0 then graph opens down

Here the graph opens up , then coefficient of f(x) is positive

-------------------------------------------------------------

the solutions to f(x) = 0 are the values of x on the x- axis where the graph crosses.

the solutions are x = 2 and x = - 3

Which function has the greatest x-intercept?
Of(x) = 3x -9
Og(x)= x + 31
h(x) = 2* - 16
Oj(x) = -5(x - 2)²

Answers

Answer:

I think the greatest x- intercept is f(x)=3x-9

PLEASE HELP I’LL MAKE YOU THE BRAINIEST
find the area of the trapezoid to the nearest tenth

Answers

Answer:

2.7m

Step-by-step explanation:

1.0m

0.5m

+1.2m

2.7m - answer

find this expression in square form with process pls help me !!!!​

Answers

Answer:

(p -3q )(p -3q  )

Step-by-step explanation:

p'2 - 6pq + 9q'2

(p -3q )(p -3q  )

find two values that add to give 6 and multiply to 9

p x p =p'2

-3q x p = -3pq   -3 x pq = -3pq    ...... -3pq - 3pq = -6pq

-3q x - 3q = 9q'2

Find the area of a trapezoid shown:

Answers

The area of this trapezoid is A = 55

We know that the application formula for calculating the area of a trapezoid is given by:

[tex] \boxed{ \large \sf A = \dfrac{(b + b) \times h}{2} } \\ \\ [/tex]

⚘ Then, the resolution will be:

[tex]{ \large \sf A = \dfrac{(7 + 15) \times 5}{2} } [/tex]

[tex]{ \large \sf A= \dfrac {22 \times 5}{2} } [/tex]

[tex]{ \large \sf A= \dfrac {110}{2} } [/tex]

[tex]\pink{ \boxed{ \purple{ \boxed{ \large \sf A= 55 }}}} \\ \\ [/tex]

Therefore, the area of this trapezoid will be, A = 55

Other Questions
the prom committee is made up of 8 boys and girls. If there are 12 boys and 15 girls in the group to pick the committee from, how many ways can the committee be organized?1). 1860 ways2). 3185325 ways3). 2220075 ways4). 675675 waysThanks guys!! Does the table below represent a function? Why or Why Not? What are two possible measures of the angle below? A baseball is thrown into the air from a height of 5 feet. the ball reaches a maximum height of 43.5 feet and spends a total of 3.2 seconds in the air. which equation models the height of the baseball? assume that acceleration due to gravity is 16 ft/s2. h(t) = 16t2 49.64t 5 h(t) = -16t2 5t 49.64 h(t) = -16t2 49.64t 5 h(t) = 16t2 5t 49.64 After the soviet union collapsed, it was replaced by. Write down the different ways in which people of different culture and nations unite as one and be considered as a single citizen of the world. Dont know how to solve Which description best identifies the unique attributes of connective tissue?. if someone is predisposed to a disease they are more likely to contract the disease to A researcher wishes her patients to try a new medicine for depression. how many different ways can she select 5 patients from 50 patients? a. 1.2K =what is the ohms It cost Makayla $2.80 to send 28 text messages. How much would it cost to send 163 text messages? All aspects of the Kirby-Bauer test are standardized to assure reliability. What might be the consequence of pouring the plates 2mm deep instead of 4mm deep please help Which statement is true about a nickel-cadmium dry cell?The anode reaction is NiO2+H2O+2eNi(OH)2+2OH.The cathode reaction is Cd+2OHCd(OH)2+2e.The cathode reaction is NiO2+H2O+2eNi(OH)2+2OH.The cathode reaction is Cd+NiO2+2H2OCd(OH)2+Ni(OH)2. A die has six sides, with the numbers 1, 2, 3, 4, 5, and 6. What is the probability of rolling a number greater than 2? Rachel rides her bike due east at 9 miles per hour. Amos rides his bicycle due north at 12 miles per hour. If they left from the same point at the same time, how far apart will they be in 1 hour? Geometry and measurement :))) help please. In a city, the distance between the library and the police station is 3 miles less than twice the distance between thepolice station and the fire station. The distance between the library and the police station is 5 miles. How far apartare the police station and the fire station?O 1 mileO 3 milesO4 milesO6 miles The probability of rain on the last day of July is 95 % . If the probability remains constant for the first seven days of August , what is the probability that it will rain at most two of those seven days in August ? Find the Mean , Standard Deviation , and Variance . If you wanted to make the graph of y=3x+1 steeper which equation could you use PLSS ANSWER MY QUESTION IN THE PICTURE NONSENSE ANSWER REPORT WRONG ANSWER REPORT CORRECT ANSWER brainlist or follow