Sodium metal reacts violently with water and chlorine is a toxic gas, yet we eat sodium chloride. Why is this possible? Select one: a. The properties of compounds are different from the properties of the elements that form the compounds.
b. The properties of compounds are identical to the properties of the elements that form the compounds, and we should not eat sodium chloride because it is toxic.
c. The physical properties of compounds are different from the physical properties of the elements that form the compounds, but the chemical properties of the elements and compound are the same.
d. The chemical properties of compounds are different from the chemical properties of the elements that form the compounds, but the physical properties of the elements and compound are the same.

Answers

Answer 1

Answer:

The properties of compounds are different from the properties of the elements that form the compounds.

Explanation:

When elements form compounds, their properties are significantly modified. The physical and chemical properties of compounds and that of the elements that compose them are significantly different.

The introduction of chemical bonds between different atoms in compounds make the compounds to differ from elements where the atoms are bonded to atoms of the same element.


Related Questions

What is the correct name for the following compound: P2Br5

Answers

Answer:

Diphosphorus pentabromide is the official name.

Explanation:

Which is the molecular shape of water, H20, according to the VSEPR theory?
A. Bent
B. Tetrahedral
C. trigonal pyramidal
D. Trigonal planar

Answers

Answer:

the answer is A

Explanation:

Which best describes why NH4+ can form an ionic bond with CF?

Its outermost shell gains one or more electrons from CF.

Its positive charge is attracted to the negative charge of Cr.

It has a negative charge that is spread over the entire ion.

It has a nitrogen atom that is strongly attracted to Cr.

Answers

Answer:

Its positive charge is attracted to the negative charge of Cl-

Note: The correct question is given below:

Which best describes why NH4+ can form an ionic bond with Cl-?

Its outermost shell gains one or more electrons from Cl-.

Its positive charge is attracted to the negative charge of Cl-.

It has a negative charge that is spread over the entire ion.

It has a nitrogen atom that is strongly attracted to Cl-.

Its positive charge is attracted to the negative charge of Cl-.

Explanation:

An ammonium ion is a positively charged ion which is composed of a molecule of ammonia and a hydrogen ion which are in a coordinate covalent bond due to the lone pair of electrons of the nitrogen atom in the molecule ammonia. The chloride ion however, has an extra electron which gives it a negative charge.

An ionic bond is formed between two oppositely charged ions by a transfer of electrons from one atom to another. It usually occurs between non-metals and metals. However, that formed between ammonium ion and chloride ion is between non-metals entirely.

Due to electrostatic attraction between the oppositely charged ions, an ionic bond is formed between ammonium ion, NH4+, and chloride ion, Cl-.

pls I need help give away 11 points
A particle has a nucleus that contains 10 protons and around the outside it has 8 electrons. What is the overall charge of the particle?
0
+2
-2
+18

Answers

Answer:

The charge is +2

Explanation:

Protons are positive, electrons are negative. 10-8=2.

+2 :)

A particle has a nucleus that contains 10 protons and around the outside it has 8 electrons, the overall charge of the particle is +2. Therefore, the correct option is option B.

What is atom?

The smallest unit of matter that may be split without producing electrically charged particles is the atom. It is also the smallest piece of substance with chemical element-like characteristics. As a result, the atom serves as the fundamental unit of chemistry.

Space makes up the majority of an atom. The remainder is made up of a cloud of electrons with negative charges around a positive-charged nucleus made up of protons and neutrons. Compared to electrons, that are the lightest positive ions in nature, the nucleus is tiny and dense. A particle has a nucleus that contains 10 protons and around the outside it has 8 electrons, the overall charge of the particle is +2.

Therefore, the correct option is option B.

To know more about atom, here:

https://brainly.com/question/29712157

#SPJ6

Calculate the speed for a car that went a distance of 150 kilometers in 2 hours time. btw this is science

Answers

Answer:

The speed of the car is 75 km per hour

Explanation:

Speed is distance over time so 150 km divided by 2 hours is 75km per hour.

Please mark brainliest!!! Thanks.

What is the pressure inside a 2.0 L bottle filled with 0.25 mol of carbon dioxide gas at 25 °C?

Answers

Answer:

3.1atm

Explanation:

Given parameters:

Volume of gas = 2L

Number of moles  = 0.25mol

Temperature  = 25°C = 25 + 273  = 298K

Unknown:

Pressure of the gas = ?

Solution:

To solve this problem, we use the ideal gas equation.

This is given as;

       PV  = nRT

P is the pressure

V is the volume

n is the number of moles

R is the gas  constant  = 0.082atmdm³mol⁻¹K⁻¹

T is the temperature

          P  = [tex]\frac{nRT}{V}[/tex]  

 Now insert the parameters and solve;

         P  = [tex]\frac{0.25 x 0.082 x 298}{2}[/tex]   = 3.1atm

For a certain chemical reaction, the bond energy of the reactants is 43 kJ, and 35 kJ of energy is released. For energy to be conserved, what is the bond energy of the products?

Answers

Answer:

78kJ

Explanation:

Energy change = Energy in (reactants) - Energy out (products)

According to this question, energy is released, meaning that the reaction is EXOTHERMIC. Hence, the energy change will be negative (-) i.e bond energy of reactants is greater than bond energy of products.

Energy in = bond energy of reactants = 43kJ

Energy out = bond energy of products = ?

Energy change of exothermic reaction = -35kJ

Therefore;

-35kJ = 43kJ - x

x = 35kJ + 43kJ

x = 78kJ

The bond energy of the products is 78kJ.

the process that breaks down rocks

Answers

Weathering is the breaking down or dissolving of rocks and minerals on earths surface!

7. Which of the following is unlikely to
happen to zinc?
A) It is rolled into sheets.
B) It is used to coat a steel hull.
C) It is used in a battery.
D) It is used as an insulator.

Answers

Answer:D) it is used as an insulator

Explanation:

Choose the balanced chemical equation below that best represents the following reaction:

When baking soda (NaHCO3) reacts with hydrochloric acid (HCl), carbon dioxide bubbles (CO2) are created, along with water (H2O) and sodium chloride (NaCl).




NaCl + H2O → NaHCO3 +CO2 + HCl


CO2 +H2O + NaCl → NaHCO3 + HCl


NaHCO3 + HCl → CO2 + H2O + NaCl


HCl + NaCl + H2O → NaHCO3 +CO2

Answers

The balanced chemical equation :

NaHCO₃ + HCl → CO₂ + H₂O + NaCl

Further explanation

A balanced chemical reaction shows that the number of atoms of the reactant and the number of atoms of the product is the same

When baking soda (NaHCO3) reacts with hydrochloric acid (HCl), carbon dioxide bubbles (CO2) are created, along with water (H2O) and sodium chloride (NaCl) .

This statement shows that

Reactants (located to the left of the reaction)

Baking soda (NaHCO₃) and Hydrochloric acid (HCl)

product (located to the right of the reaction)

Carbon dioxide(CO₂),water  (H₂O) and Sodium chloride (NaCl).

So the reaction :

NaHCO₃ + HCl → CO₂ + H₂O + NaCl

a gas tank is under 1 atm pressure at room temperature. if the temperature halved,what will happen to the pressure ​

Answers

Answer:

The pressure will also be halved.

Explanation:

Gay-Lussac's law states that the relationship between temperature and pressure is directly proportional to each other. If the temperature goes up, so will the pressure.

what is the electical charge on the nucleus of the boron atom ?

Answers

Boron have 5 protons and only 4 electrons, which means that it has a positive charge.
(The charge is +1)

Hope this helped!

_________feedback is a type of feedback in which a system is triggered to produce an output.

Answers

Answer:

positive

Explanation:

Answer:

Positive feedback is a type of feedback in which a system is triggered to produce an output.





Explanation:

Have a great rest of your day
#TheWizzer

Suggest a change of state, other than ice melting, that is an endothermic
process.​

Answers

Answer:

Vaporization and Sublimation

Explanation:

Answer:

Well there's solid states, liquid states, and gas states in matter.

carbon and tin are both in the fourth column of the table which would you expect to have the greater electronegativity

Answers

Answer: Carbon

Explanation:

electronegativity decreases when you go down a column

The study of chemical bonds is called chemistry.

The correct answer is carbon.

The more negative charge present on an atom shows the electronegativity.

The attraction of the nucleus to the proton is also referred to as electronegativity.

The smaller the radius more the electronegativity.

Hence, the correct answer is Carbon as it has fewer atoms and a smaller radius.

For more information, refer to the link:-

https://brainly.com/question/12985618

OK HURRY AND PLEASE ANSWER COZ THIS TEST IS TIMED BROS

What is the sum of the coefficients in the balanced chemical equation for the combustion of acetone, C3H6O(l), in air?
Express answer as an integer

Answers

Answer:

C3H6O + 4O2 → 3CO2 + 3H2O or 11

Explanation:

Answer:

11

Explanation:

Match these solutions with their examples:
Liquid in liquid
Solid in liquid
gas in liquid
gas in gas
solid in solid
liquid in solid
Gas in solid

Examples
A. Air
B. seawater
C. marshmallow

Answers

Answer:

sea water

Explanation:

a sea water can match the following

which description of salt is a chemical property?

No combustion

Odourless

salty taste

solid does not conduct electricity

Answers

Answer: No combustion

Explanation:

Helpppppp!!!!! It’s due today
URGENT!!!!!

Answers

Answer:

Explanation:

2. a [CO3 2-][H3O+] / [H2O][HCO3-

b. [H2PO4-][H3O+]/[H3PO4][H2O]

Describe how the molecular models you assembled are similar to real molecules.
They model how real molecules are.

Answers

Answer:

Atoms models are bigger but they don not match the true or positive way of atoms. to make them visible scientists make their models that resembled with the real ones.

Explanation:

Molecules are microscopic entities and only can be seen under a  microscope.

Determine which equations you would use to solve the following problem: Calculate the amount of heat needed to change 20.0 g of ice at -10.0°C to water at 89.0°C.

Answers

Answer:

Q = 4019.4 J

Explanation:

Given data:

Mass of ice = 20.0 g

Initial temperature = -10°C

Final temperature = 89.0°C

Amount of heat required = ?

Solution:

specific heat capacity of ice is 2.03 J/g.°C

Formula:

Q = m.c. ΔT

Q = amount of heat absorbed or released

m = mass of given substance

c = specific heat capacity of substance

ΔT = change in temperature

ΔT = T2 - T1

ΔT =  89.0°C - (-10°C)

ΔT = 99°C

Q = 20.0 g ×2.03 J/g.°C × 99°C

Q = 4019.4 J

The “rise” of the muffin is caused by the release of ___________ gas trapped in the mix as it is heated. carbon dioxide hydrogen oxygen helium

Answers

Answer:

Carbon dioxide

Explanation:

In the making of the muffins, there are many ingredients are used including flour, egg, butter, sugar, and flavoring of fruits. There is also a raising agent, the baking powder or baking soda used that reacts with the batter.

This reaction form bubbles of carbon dioxide, trapped in the air spaces during the baking and muffin raises. Carbon dioxide makes muffins light, by lifting the batter as it bakes.

Astronomers observed that the orbit of Uranus was not uniform. Therefore, they hypothesized the existence of another planet. This is an example of scientific investigation being led by _____.

Inductive Reasoning
Deductive Reasoning

Answers

Answer:

This is an example of scientific investigation being led by inductive reasoning.

Explanation:

Inductive reasoning is the type of reasoning used to make broad generalizations from specific observations. We have certain pieces of data and make conclusions based on them. In the given example, astronomers have made a specific observation - that the orbit of Uranus isn't uniform. Based on that fact, they made a broader conclusion - that there is another planet. There are probably more things that could lead to the same conclusion.

The opposite is deductive reasoning, where a person starts off with a broad generalization and tries to make specific, logical conclusions based on it.

Which things are larger than cells? Put an X next to (or highlight) the things that are generally larger than a typical animal or plant cell.


_____thickness of a leaf ____grain of salt
_____atom _____protein molecule
_____width of hair x DNA
_____piece of sawdust _____eye of an ant
_____Water molecule _____tiny seed
_____bread crumb _____larva of a tiny fruit fly
_____bacteria _____period at end of sentence _____ virus
_____speck of pepper _____chromosome _____ frog embryo _____dust mite _____point of a pin _____ flea egg

Answers

Answer:

Explanation:

x thickness of a leaf x grain of salt

_____atom _____protein molecule

x width of hair x DNA

x piece of sawdust x eye of an ant

_____Water molecule x tiny seed

x bread crumb x larva of a tiny fruit fly

x bacteria x period at end of sentence _____ virus

x speck of pepper _____chromosome x frog embryo x dust mite xpoint of a pin x flea egg

What is arcade in south Center

Answers

Answer: game stop and mind games

Explanation:

i live near there

What information can a foliated metamorphic rock provide you about the conditions under which it formed?

Answers

A foliated rock forms when the minerals are realigned due to the presence of high temperature and pressure. The minerals align in such a way that the axes are directed to where the pressure was applied.

Analysis of a sample of an oxide of nitrogen gave 47% of nitrogen.What is the empirical formula of the oxide?

Answers

Answer:

N2O

Explanation:

hope am right.....

How are convalent molecules named?

Answers

Covalent compounds are named by using numerical prefixes to identify the number of atoms in the molecule. E.g. Mono, Di, tri, tetra, etc.

In the naming, never use mono- for the first element.

The first element keeps its name.

The second element always end in the suffix -ide.

Drop the double vowel for the prefix and the element of the second element in the compound.

Hope this helped!

How many moles of hydrogen
are in 3.7 moles of C8H11 NO2?

Answers

40.7 because I know

How many molecules are there in 8.25 moles of CaHia?

Answers

The number of molecules : 4.967 x 10²⁴

Further explanation  

A mole is a number of particles(atoms, molecules, ions)  in a substance

This refers to the atomic total of the 12 gr C-12  which is equal to 6.02.10²³, so 1 mole = 6.02.10²³ particles  

Can be formulated :

N = n x No

N = number of particles

n = mol

No = 6.02.10²³ = Avogadro's number

8.25 moles of C₈H₁₈

The number of molecules :

[tex]\tt 8.25\times 6.02\times 10^{23}=4.967\times 10^{24}[/tex]

Other Questions
Cell biologists studying the mobility of plasma membrane proteins fused mouse and human cells together, creating a heterokaryon. They then examined the localization of mouse and human proteins over time. Initially the mouse and human proteins were restricted to separate halves of the heterokaryon. Over time the mouse and human proteins mixed, with each protein eventually being present over the entire cell surface, consistent with proteins being able to move within the plane of the membrane. What techniques could have been used to examine the locations of the mouse and human membrane proteins Put the steps in order? What best explains how geography affected the economy of ancient Greece?A. The ancient Greeks supported themselves by fishing in the seas.B. The warm climate allowed the ancient Greeks to farm all year long.C. The rocky terrain helped the ancient Greeks develop overland trade routes.D. The ancient Greeks used trees from their forests to build ships for neighboring cultures. Why do lunar and solar eclipses not happen every month? -Eclipses only occur during full and new moons. -Earth rotates around its axis faster than the moon. -The moon and Earth only travel through the penumbras. -The moons axis does not always align with Earths shadow. Explain how King (MLK) thinks God is involved in the civil rights movement. How would you synthesize 1-hexanol starting from 1-propanol, incorporating a Grignard reagent in the synthesis? Which element is described by words such as bright, dark, and mellow? Assessment started: undefined.Item 1Read the sentence.Alberto hates tomatoes yet adores spaghetti.What is the function of the word yet in the sentence?adjectiveprepositionadverbconjunction please please help me!! Please help with the problem in the picture ^ Ill give brainliest if you give me a small explanation! :) "It's just that . . . without the memories it's all meaningless. They gave that burden to me. And to the previous Receiver. And the one before him." "And back and back and back," Jonas said, knowing the phrase that always came. The Giver smiled, though his smile was oddly harsh. "That's right. And next it will be you. A great honor." "Yes, sir. They told me that at the Ceremony. The very highest honor." The Giver by Lois Lowry Part A What is the Giver's point of view about his role in the community? what is the difference between the spermatozoon and spermatogonium? Which statement is Irue about the given information?+BDE Shiras Shoes sold 875,000 pairs of sandals in June, which was 70% of the total number of shoes sold. How many shoes did the company sell in June? Analyze Emilys calculations. What error did she make? d. From which longitude, Nepal's standard time has been determined? In seedless plants, haploid gametophytes are produced fromA; diploid spores that undergo mitosis.B: haploid spores that undergo meiosis.C; diploid spores that undergo meiosis.D; haploid spores that undergo mitosis. Based on your knowledge of the definitions of these words, what does the root word port mean A square patio has an area of 182 square feet. How long is each side of the patio to the nearest tenth? This question has three parts. Answer the parts in order.Part 1Sam is 8 years younger than his brother Steve. He is also half as old as Steve.Select two equations of a system that can be solved to find both ages.Part 2How many years old is Sam? (Use only the digits 0 9 to enter a number.)Part 3How many years old is Steve? (Use only the digits 0 9 to enter a number.)this are the answeres of part one What is 1 5/9 as a percent?