Which of the following is equal to
OA. Speed
OB. Displacement
OC. Velocity
OD. Acceleration
distance
time
SUBI

Answers

Answer 1

Answer:b

Step-by-step explanation:


Related Questions

Translate this sentence into an equation.
24 more than Craig's height is 68.
Use the variable c to represent Craig's height.

Answers

We can begin by focusing on c on one side of the equation to help us solve it. Craig's height is 44 as a result.

What is Equation?

A mathematical equation is a claim that two expressions are equivalent. It is divided into two sections, the left and the right, by the equal sign (=). Equation's left and right sides each have the potential to include variables, constants, and operators.

Finding the value(s) of the variable(s) necessary to make an equation true is the aim of equation solving. Algebraic techniques like simplification, substitution, and elimination can be used to solve equations.

An equation can be used to represent the following sentence:

c + 24 = 68

Craig's height is represented by c in this equation. The equal sign (=) is used to symbolise the phrase "is 68," while the phrase "is 24 more than Craig's height" is symbolised by c + 24. The formula for the problem can be solved to find the value of c, which corresponds to Craig's height.

We can begin by concentrating c on just one side of the equation in order to solve it:

c + 24 - 24 = 68 - 24

c = 44

Therefore, Craig's height is 44.

To know more about Expression, visit:

brainly.com/question/1859113

#SPJ1

7

7

?

?

Find the arc length of the partial circle.

Either enter an exact answer in terms of

π

πpi or use

3.14

3.14, point, 3.14 for

π

πpi and enter your answer as a decimal.

units

Answers

According to given information, the arc length of a partial circle is 14.67 units.

What is partial circle?

A partial circle is a portion of a circle, usually defined by an angle that is less than 360 degrees.

According to given information:

To find the arc length of a partial circle, we need to know the measure of the central angle, θ, in radians.

Let's say that the central angle of the partial circle is 2π/3 radians, which corresponds to an angle of 120 degrees.

Then, the arc length, denoted by L, can be calculated using the formula:

L = rθ

where r is the radius of the circle.

Plugging in the values we have, we get:

L = 7(2π/3)

L = (14/3)π

Using 3.14 for π, we get:

L ≈ 14.67 units (rounded to two decimal places)

To know more about partial circle visit:

https://brainly.com/question/30502384

#SPJ1

4. Mackenzie's dog can jump 2 1/2 feet off the ground. Jordyn's dog can
jump 1/2 foot off the ground. What is the difference in inches between
2how high Mackenzie's dog can jump and how high Jordyn's dog can
jump? Circle what to do to solve this problem.

Answers

The difference in the length of dogs jump is 24 inches.

Given that, Mackenzie's dog can jump [tex]2\frac{1}{2}[/tex] =5/2 feet off the ground. Jordyn's dog can jump 1/2 foot off the ground.

We know that, 1 feet = 12 inches

Here, 5/2 feet = 5/2 ×12

= 30 inches

1/2 foot = 1/2 ×12

= 6 inches

Now, difference = 30-6 = 24 inches

Therefore, the difference in the length of dogs jump is 24 inches.

To learn more about the metric conversion visit:

brainly.com/question/21244256.

#SPJ1

18.
Simplify.
y²-6y +11
y-2
Oy-1
Oy³-8y² +23y - 22
none of the answer choices
Oy²-5y +9
O-y²-2y + 10

Answers

Answer:

the answer is none of the answer choices

Answer:

the answer is none of the answer choices

PLEASE HELP NOW ITS DUE TONIGHT!!!!

A zip line is constructed across a valley, as shown in the diagram. What is the width w of the valley? Round your answer to the nearest tenth.

w ≈__ft

Answers

Answer: 92.5

Step-by-step explanation:

Answer:

w = 92.5

Step-by-step explanation:

You cannot use Law of Sine in this case.

Use Law of Cosine.

They gave you 2 side length and one angle.

plug in your values into the equation and solve for w.

Let just use u, v, & w: Let u be 25 and v be 84.

[tex]w^2 = u^2 + v^2 - 2*u*v*cos(W)[/tex]

[tex]w^2 = 25^2 + 84^2 - 2*25*84*cos(102)[/tex]°

[tex]w^2=625+7056-4200*cos(102)[/tex]

[tex]w^2=7681-4200*(-0.2079116908)[/tex]

[tex]w^2=7681+873.2291014[/tex]

[tex]w^2=8554.229101[/tex]

[tex]w=\sqrt{8554.229101}= 92.48907558[/tex]

1. Order the following rational numbers from least to greatest: -5/6, -0.2001, 20%, -78​

Answers

Answer:

-78, -5/6, -0.2001, 20%

Step-by-step explanation:

The first step is to convert all of the numbers into the same form. In this case, it is easiest to use decimal form.

-5/6 = -0.8333...

-0.2001

20% = 0.2

-78

-78 is the smallest by far

-0.8333... is the next smallest

-0.2 is next

and 0.2 is the largest

As seen in the diagram below, Dalvin is building a walkway with a width of x x feet to go around a swimming pool that measures 7 feet by 9 feet. If the total area of the pool and the walkway will be 143 square feet, how wide should the walkway be?

Answers

Answer: 2

Step-by-step explanation:

(7+2x)(9+2x)= 143 (area= length x width)

63+14x+18x+4x^2=143

4x^2+32x−80=0

x^2+8x−20=0

(x−2)(x+10)=0

x = 2 or -10

Since the length of the walkway can't be negative, the answer is 2.

Please answer this question, I’ll give brainliest, and no chat gpt

Q7. A 230 kg piano must be lifted onto a stage that is 1.7 m high.
(a) If the piano is lifted straight up by some very strong people, how much force must they apply? [2 marks]
(b) How much work have they done? [2 marks]
(c) If the stage-crew only need to apply a force of 300 N to get the piano onto the stage if they use a 15 m ramp. How much work is done using the ramp? [2 marks]
(d) What is the efficiency of the ramp? [2 marks]
(e) You should notice that the force needed to lift the piano in A is larger than the force needed to lift the piano in C. How is it possible that the piano can be raised with much less force when the incline is used? (In other words, what is the "trade-off" of using an inclined ramp?) [2 marks]

Answers

1. The force they must apply is 2256.3 N

2. The amount of work done = 3835.71 J

3. The work done using the ramp = 4500 J

4.  The efficiency of the ramp = 85.24%

5. When the people use inclined ramp, they don't have worry about the gravitational force that is acting on the piano. The trade off with with less force, the ramp is able to cover more distance.

How do we find force applied, work done, and efficiency of ramp?

1. To find force applied, used the formula; F = mg

230 x 9.8N

=2256.3N

2. To find the amount of work done, we use the formula;

W = Fd

2256.3 x 1.7 m

= 3835.71J

3. o calculate the work done using the ramp, you use the same formula you used in step 2

300N x 15m

= 4500J

Find more exercises on calculating force applied;

https://brainly.com/question/15262937

#SPJ1

Charlie made a start using 1/8 yards of red fabric and 1/3 yards of yellow fabric. How many yards of fabric did he use in all? Write your answer as a fraction in simplest form.

Answers

Answer:

[tex]\frac{11}{24}[/tex] yards

Step-by-step explanation:

[tex]\frac{1}{8}[/tex] + [tex]\frac{1}{3}[/tex]  we need a common denominator which is 24

[tex]\frac{1}{8}[/tex] x [tex]\frac{3}{3}[/tex] = [tex]\frac{3}{24}[/tex]

[tex]\frac{1}{3}[/tex] x [tex]\frac{8}{8}[/tex] = [tex]\frac{8}{24}[/tex]

[tex]\frac{3}{24}[/tex] + [tex]\frac{8}{24}[/tex] = [tex]\frac{11}{24}[/tex] yards

Helping in the name of Jesus.

Answer the following questions

Answers

A 524 eighth tbh tbh bef EDC

math complementary angles

Answers

Answer: ∠BDA

Step-by-step explanation:

Complementary: Either of two angles whose sum is 90°.

Starting Angle: ∠BDC

Possible Complement: ∠BDA

Answer: ∠ACD

Step-by-step explanation:

Complementary angles are angles which have a sum of 90 degrees when added together.

Angle ∠ADB is 90°

So ∠BDC and another angle should give you ∠ADB

The angle that when added to ∠BDC give you ∠ADB is ∠ACD

I need the area choices below

Answers

Answer:

Area of the shape is 244.98cm² is B

Step-by-step explanation:

Area of shape=Area of semi circle+Area of trapezoid

A=1/2 πr² + 1/2(a+b)h

A=1/2×3.142×7² + 1/2(14+18)10.5

A=1/2×3.142×49 + 1/2×32×10.5

A=76.98+168

A=76.98+168

A=244.98cm²

Now, find the solution to the system of equations

Answers

The solution of equation is (2, 3).

We have,

x= 3y -7.........(1)

y= x + 1.........(2)

Solving equation (1) and (2) we get

y = 3y - 7 + 1

y - 3y = -7 + 1

-2y = -6

y = -6/(-2)

y = 3

and, x = 3(3) - 7

x = 9 - 7

x = 2

Thus, the solution of equation is (2, 3).

Learn more about Equation here:

https://brainly.com/question/29657983

#SPJ1

I’m unsure where to plot the five points and shade in

Answers

The image is attached of the graph of the inequality y < 4x - 5.

What is the inequality equation?

An inequality equation is a mathematical statement that compares two expressions using an inequality symbol such as < (less than), > (greater than), ≤ (less than or equal to), or ≥ (greater than or equal to).

To graph the inequality y < 4x - 5 using the slope-intercept form, follow these steps:

Rewrite the inequality in slope-intercept form, y = mx + b, where m is the slope of the line and b is the y-intercept.

y = 4x - 5

Plot the y-intercept on the y-axis.

The y-intercept is -5, so plot the point (0, -5).

Use the slope to find a second point on the line.

The slope is 4, so start at the y-intercept and move up 4 units and to the right 1 unit to find the point (1, -1).

Draw a dashed line through the two points.

Since the inequality is y < 4x - 5, use a dashed line to indicate that the line itself is not part of the solution.

Shade the region that satisfies the inequality.

To do this, pick a test point that is not on the line and plug its coordinates into the inequality. If the inequality is true for that point, shade the region that contains the test point. If the inequality is false for that point, shade the region that does not contain the test point.

Let's use the test point (0, 0). Plug its coordinates into the inequality to get:

0 < 4(0) - 5

This simplifies to 5 < 0, which is false. Therefore, we need to shade the region that does not contain the test point.

Since the inequality is y < 4x - 5, we need to shade the region below the dashed line.

Label the shaded region with the inequality symbol.

The inequality is y < 4x - 5, so label the shaded region below the dashed line with the symbol "<".

hence, The image is attached of the graph of the inequality y < 4x - 5.

To know more about inequality equations visit :

https://brainly.com/question/30238989

#SPJ1

The following residual plot is obtained after a regression equation is determined for a set of data. Does the residual plot indicate that the regression equation is a good model or a bad model of the data? Why or why not?

Answers

The residual plot shows that the regression equation is a good model of the data because it shows a random scatter of points around a horizontal line at zero, with no pattern or trend

What makes a residual plot a good model?

A residual plot is a scatter plot of the residuals against the predictor variable(s) or the fitted values. It is used to verify whether the regression equation fits the data well.

In the event that the residual plot shows a random scatter of points around a horizontal line at zero, with no pattern or trend, it shows that the regression equation is a good model of the data.

On the other hand, supposing the residual plot shows a pattern or trend, such as a curve, a U-shape, or a funnel shape, it shows that the regression equation is a bad model of the data.

Therefore, from the graph given, the residual plot shows that the regression equation is a good model of the data.

learn more about residual plot: https://brainly.com/question/16821224

#SPJ1

Look at the simultaneous equations below. (1) 18 = 7x - y (2) 3x + y = 2 a) Rearrange equation (1) to make y the subject. b) Using your answer to part a), solve the simultaneous equations ck to task Watch video
Answer:
Explanation:

Answers

The solution to the simultaneous equations is x = 2 and y = -4. To obtain these values,  18 = 7x - y  is rearranged to y = 7x - 18, and then substituted into 3x + y = 2  to obtain the value of x and y.

Rearranging equation (1) to make y the subject

18 = 7x - y

Add y to both sides

18 + y = 7x

Subtract 18 from both sides

y = 7x - 18

Using the answer to part a) to solve the simultaneous equations

Substitute the expression for y from equation (1) into equation (2)

3x + (7x - 18) = 2

Simplify

10x - 18 = 2

Add 18 to both sides

10x = 20

Divide both sides by 10

x = 2

Substitute x = 2 into equation (1) to find y

18 = 7(2) - y

18 = 14 - y

Subtract 14 from both sides

4 = -y

Multiply both sides by -1

-4 = y

Therefore, the solution to the simultaneous equations is x = 2 and y = -4.

To know more about solution of equation:

https://brainly.com/question/545403

#SPJ1

Wenona sketched the polynomial P(X) as shown on the axes below.

Which equation could represent P(X)
A.P(X)=(x+1)(x-2)^2
B.P(X)=(x-1)(x+2)^2
C.P(X)=(x+1)(x-2)
D.P(X)=(x-1)(x+2)

Answers

An equation that could represent P(x) include the following: A. P(x) = (x + 1)(x - 2)²

What is a polynomial graph?

In Mathematics and Geometry, the graph of a polynomial function touches the x-axis at zeros, roots, solutions, x-intercepts, and factors with even multiplicities.

Also, the graph has a zero of multiplicity 2 at x = 2 and zero of multiplicity 1 at x = -1;

x = 2 ⇒ x - 2 = 0.

(x - 2)²

x = -1 ⇒ x + 1 = 0.

(x + 1)

In this context, an equation that represent the polynomial function is given by:

p(x) = a(x - 2)²(x + 1)

By evaluating and solving for the leading coefficient "a" in this polynomial function based on the y-intercept (0, 4), we have;

4 = a(0 - 2)²(0 + 1)

4 = a4

a = 4/4.

a = 1

Therefore, the required polynomial function is given by:

p(x) = (x - 2)²(x + 1)

Read more on polynomial and multiplicity here: brainly.com/question/13652616

#SPJ1

$900 is deposited in an account with 4%
interest rate, compounded continuously.
What is the balance after 10 years?
F = $[?]

Answers

Answer:

[tex]\$1342.64[/tex]

Step-by-step explanation:

We can represent the value [tex]A[/tex] of a quantity [tex]P[/tex] compounded continuously for [tex]t[/tex] years at [tex]r[/tex] rate of interest as:

[tex]A = P\cdot e^{rt}[/tex]

This formula uses the mathematical constant [tex]e[/tex] (approx. 2.72), which is the theoretical limit for continuous compounding.

Plugging the given values into the formula:

[tex]A = \$900 \cdot e^{(0.04 \, \cdot \, 10)}[/tex]

We can now solve for [tex]A[/tex].

↓ simplifying [tex]e[/tex]'s exponent

[tex]A = \$900 \cdot e^{0.4}[/tex]

↓ plugging into a calculator

[tex]A \approx \$1342.64222788[/tex]

↓ rounding to the nearest cent

[tex]\boxed{A \approx \$1342.64}[/tex]

A bacteria culture initially contains 2500 bacteria and doubles every half hour.

Find the size of the baterial population after 20 minutes.


Find the size of the baterial population after 4 hours.

Answers

Answer:

After half hour=30 min you have 2×2500=5000 bacteria so you can use this into your equation to write:

and:

Apply the natural logarithm ln to both sides and get:

so  in units of

so your equation is now:

1] it t= 50 min substituting you get:

bacteria

2] if t= 8 h = 480 min you get:

bacteria

Step-by-step explanation:

how exactly am i supposed to locate? please help​

Answers

Answer:

We can use the vector addition property to find the coordinates of the points M, N, and I.

Let

[tex]\bold{ A = (x_1, y_1), B = (x_2, y_2), C = (x_3, y_3), and\: D = (\frac{x_2+x_3}{2}, \frac{y_2+y_3}{2})}[/tex]

To find M, we use the fact that MA + MB = 0. Therefore, we have:

MA = -MB

A - M = -(B - M)

A - M = -B + M

2M = A + B

M =[tex]\frac{A + B}{2}[/tex]

So, the coordinates of point M are

[tex]\bold{(\frac{x_1+x_2}{2}, \frac{y_1+y_2}{2})}[/tex]

To find N, we use the fact that 3NA + NC = 0. Therefore, we have:

3NA = -NC

3A - N = -(C - N)

3A - N = -C + N

4N = 3A + C

N =[tex]\frac{ 3A + C}{4}[/tex]

So, the coordinates of point N are [tex]\bold{(\frac{3x_1+x_3}{4},\frac{ 3y_1+y_3}{4})}[/tex]

To find I, we use the fact that IM + 2IN = 0. Therefore, we have:

IM = -2IN

M - I = -2(N - I)

M - I = -2N + 2I

3I = M + 2N

I = [tex] \frac{(M + 2N)}{3} [/tex]

Substituting the values of M and N that we found earlier, we get:

I = (A + B + 2(3A + C)/4)/3

Simplifying this expression, we get:

I = [tex]\frac{(7A + 2B + 2C)}{12}[/tex]

So, the coordinates of a point I are[tex]\bold{(\frac{7x_1+2x_2+2x_3}{12}, \frac{7y_1+2y_2+2y_3}{12}).}[/tex]

To wrap gift boxes joelle uses 24 yards if ribbon which us 8% of her total amount of ribbon. How many ribbons does she gave jn all

Answers

Joelle gave a total of 300 yards of ribbon in all

How many ribbons does she gave in all

Let's assume that the total amount of ribbon Joelle has is "x" yards.

We know that 24 yards of ribbon is 8% of her total amount of ribbon. So we can write an equation:

0.08x = 24

To solve for x, we divide both sides of the equation by 0.08:

x = 24 ÷ 0.08

x = 300

Therefore, Joelle has a total of 300 yards of ribbon.

Read more about percentage at

https://brainly.com/question/24877689

#SPJ1

Answer:

Step-by-step explanation: the answer is 300 just divide and you’ll get the answer that simple

x^2+7x-9 + 2x-1 what is the polynomial and degree

Answers

Answer:

The given expression is a polynomial:

f(x) = x^2 + 7x - 9 + 2x - 1

Combining like terms, we get:

f(x) = x^2 + 9x - 10

The degree of the polynomial is 2, since the highest power of x is 2.

4. Find the product

()

Answers

Answer: n^6-25

Step-by-step explanation:

Use the distributive property to obtain: n^6-5n^3+5n^3-25

Simplify: n^6-25

Answer: n^6-25

The product of the given expression [tex](n^{3} + 5) (n^{3} - 5)[/tex] will be the second option  [tex]n^{6} - 25[/tex].

This is a simple math problem that can be solved using algebraic identities. Algebraic identities are mathematical formulas that hold true regardless of the value assigned to each of the variables. They can be used to resolve equations and simplify expressions.

In the above question, we have used the following identity:

[tex](a^{2} - b^{2} ) = (a + b) (a - b)[/tex]

In the given question, a = [tex]n^{3}[/tex] and b = 5

So putting values in the identity, we get

[tex][(n^{3})^{2} - 5^{2}] = (n^{3} + 5) (n^{3} - 5)[/tex]

On solving the left side of the equation, we get

[tex]n^{6} - 25[/tex] which is our answer to the given question.

Note: [tex](n^3)^2 = n^6[/tex] because the powers get multiplied.

To know more about Algebraic Identities,

https://brainly.com/question/30338950

Can someone explain to me how to find x?

Answers

Answer:

  x° = 36°

Step-by-step explanation:

You want to find the angle between a secant and a tangent to a circle, where the intercepted arcs are 126° and 54°.

Exterior angle

The angle at D, labeled x°, is half the difference of the intercepted arcs:

  x° = (126° -54°)/2 = 72°/2

  x° = 36°

__

Additional comment

The same relationship applies for the angle between two secants.

This is easy to prove by considering triangle ADE. Angle DAE is half of arc CE. The exterior angle to the triangle at E is half of arc AE. That exterior angle is equal to the sum of the remote interior angles at D and A:

  AE/2 = x° + CE/2   ⇒   x° = (AE -CE)/2

Jenna threw a disc 18 yards to Karl, who threw it 11 yards in the same direction to Alice.
Start at 0 on the number line and move _____ to the right to represent Jenna throwing the disc to Karl.
Then move ______ to the right to represent Karl throwing the disc to Alice the result shows that.

Answers

Start at 0 on the number line and move 18 yards to the right to represent Jenna throwing the disc to Karl. Then move 11 yards to the right to represent Karl throwing the disc to Alice the result shows that.

To represent Jenna throwing the disc to Karl, we need to move 18 yards to the right on the number line. This is because Jenna threw the disc directly to Karl, so the distance between them is 18 yards. Therefore, we can start at 0 on the number line and move 18 yards to the right to represent Jenna throwing the disc to Karl.

To represent Karl throwing the disc to Alice, we need to move 11 yards to the right from Karl's position on the number line. This is because Karl threw the disc 11 yards in the same direction as Jenna threw it to him.

So, we can start at Karl's position on the number line (which is 18 yards to the right of 0) and move 11 yards to the right to represent Karl throwing the disc to Alice.

Overall, to represent the entire throwing sequence from Jenna to Karl and then to Alice, we can start at 0 on the number line and move 18 + 11 = 29 yards to the right.

To learn more about direction click on,

https://brainly.com/question/31738076

#SPJ1

The distribution of scores on the SAT is approximately normal with a mean of μ- 500 and a standard deviation of a 100. or the population of students who
have taken the SAT

a. What proportion of students have scores less than 380?

b. What proportion of students have scores greater than 639

Answers

a. The proportion of students have scores less than 380 is 11.51%.

b. The proportion of students have scores greater than 639 is 8.23%.

What is the proportion with SAT scores below 380 and above 639?

1. Using the z-score formula:

We can calculate that score of 380 corresponds to a z-score of -1.2 since z = (x - μ) / σ.

Using a standard normal distribution table, we find that:

The proportion of students with scores less than 380 is 0.1151.

2. Similarly, a score of 639 corresponds to a z-score of 1.39.

Using a standard normal distribution table, we find that:

The proportion of students with scores greater than 639 is approximately 0.0823.

Read more about distribution

brainly.com/question/4079902

#SPJ1

2x + y = 7
x + y = 1

Answers

Answer:  x = 6 and y = -5.

Step-by-step explanation: Multiply the second equation by -2 to eliminate the y term:

-2(x + y) = -2(1) -> -2x - 2y = -2

Add the resulting equation to the first equation to eliminate the y term:

2x + y = 7

-2x - 2y = -2

0x - y = 5

Solve for y:

-y = 5

y = -5

Substitute y = -5 into either of the original equations and solve for x:

x + y = 1

x + (-5) = 1

x = 6

Therefore, the solution to the system of equations is x = 6 and y = -5.

Given f(x)=x−1‾‾‾‾‾√ and g(x)=12x+5, what is the value of (f∘g)(2)?

Enter your answer in the box.

Answers

If f(x)= √(x−1) and g(x)=12x+5, then the value of (f∘g)(2) is 2√7.

What is function?

In mathematics, a function is a relationship between two sets of elements, called the domain and the range, such that each element in the domain is associated with a unique element in the range.

To find the value of (f∘g)(2), we first need to evaluate g(2), and then use the result as the input for f.

So,

g(2) = 12(2) + 5 = 24 + 5 = 29

Now, we use the value g(2) = 29 as the input for f:

f(g(2)) = f(29)

Since f(x) = √(x-1), we have:

f(29) = √(29-1) = √28 = 2√7

Therefore, the value of (f∘g)(2) is 2√7.

To learn more about functions from the given link:

https://brainly.com/question/12431044

#SPJ1

Mrs. Thomas made 31⁄2 gallons of tea for the family reunion. She estimates that each of the 17 family members will drink about 3 cups of tea that day. Did she prepare enough?

Answers

Answer is YES. She prepared enough

Step by step

There are 16 cups in 1 gallon

3.5 gallons tea made x 16 cups per gallon = 56 cups total tea made

17 family members will drink 3 cups each
17 x 3 = 51 cups she needs for the reunion

So yes, she made 56 cups and only needs 51 so she made enough

The mean score, overbar(x), on an aptitude test for a random sample of 5 students was 73. Assuming that σ = 15, construct a 95.44% confidence interval for the mean score, μ, of all students taking the test.
Question 14 options:

A)

67.0 to 79.0

B)

59.6 to 86.4

C)

43 to 103

D)

62.9 to 83.1

Answers

The 95.44% confidence interval for the mean score, μ, of all students taking the test is 59.6 to 86.4.

What is confidence interval?

A confidence interval is a range of values that is calculated from a sample of data. It provides a level of certainty, usually expressed as a percentage, that a population parameter lies within this range. It is used to estimate a population parameter, such as a mean, a proportion, or a difference between two means.

The 95.44% confidence interval for the mean score, μ, of all students taking the test can be calculated using the formula:
Confidence Interval = overbar(x) ± (1.96 x (σ/√n))
where overbar(x) is the mean score on the aptitude test, σ is the standard deviation of the population (15 in this case), and n is the sample size (5 in this case).
Plugging in the given values, we get:
Confidence Interval = 73 ± (1.96 x (15/√5))
= 73 ± (1.96 x 3)
= 73 ± 5.88
Therefore, the 95.44% confidence interval for the mean score, μ, of all students taking the test is 59.6 to 86.4.

To learn more about confidence interval
https://brainly.com/question/20309162
#SPJ1

Other Questions
PLEASE HELP! Which of the points plotted is farther away from (4, 4), and what is the distance? Point (4, 5), and it is 9 units away Point (4, 5), and it is 11 units away Point (7, 4), and it is 9 units away Point (7, 4), and it is 11 units away 9. you deposited $100 in a savings account 9 months ago. you currently have $121.30. what was the ear if the bank paid interest with monthly compounding? Identify a central idea in the Bill of Rights. which term did abraham maslow use that was roughly equivalent to carl rogerss concept of the fully functioning individual? Calculate how much sea level would rise for the water volume gained in question 1. Ignoring many important complications the much simplified equation is : the Change in sea level=change in water volume/surface area of the oceans. Round to the nearest whole number POSSIBLE POINTS: 17. 65The human population is increasing (or growing). In which ways are our fossil fuels being affected due to the higher population?The amount of carbon dioxide in the atmosphere is increasing (or growing)Political conflicts (disagreements) occur over control of these resources. These resources are being replaced faster than they are being used. The distribution of these resources is changingChose ALL that apply let p and q be distinct primes. (1) prove that (z/(pq)) has order (p 1)(q 1); Probability problem pls help me How does the Art of the Kingdom of Benin reflect global cultural influences--either influences from elsewhere upon it, or from it influencing other continents? Your answer can look beyond its own era (because these works sometimes influence later eras). one paragraph Calculate the molarity of each solution:1.) 3.25 mol of LiCl in 2.78 L solution2.) 28.33 g C6H12O6 in 1.28 L of solution3.) 32.4 mg NaCl in 122.4 mL of solution4.) 0.38 mol of LiNO3 in 6.14 L of solution5.) 72.8 g C2H6O in 2.34 L of solution6.) 12.87 mg KI in 112.4 mL of solution StructureA Select the correct verb form to complete the sentence. (10 points)1. Les lvesleurs devoirs.A.finissent2. MichalA. avons3. J(e)A. offresdouze ans.4. Ahmed, tuA. viensB. finitB. aun jeu vido mon frre.B. offreavec nous au caf?B. venez5. Laeticia et moi, nous aimons beaucoup la pizza, donc nousA. grossitB. grossisC. finissionsC. aiC. offrentC. vientC. grossissons Suppose the distribution of the time X (in hours) spent by students at a certain university on a particular project is gamma with parameters a = 40 and B = 4. Because a is large, it can be shown that X has approximately a normal distribution. Use this fact to compute the approximate probability that a randomly selected student spends at most 175 hours on the project. (Round your answer to four decimal places.) Write the chemical equation and the Ka expression for the ionization of each of the following acids in aqueous solution. First show the reaction with H+(aq) as a product and then with the hydronium ion.A) HBrO2. Show the reaction with H+(aq) as a product. Express your answer as a chemical equation. Identify all of the phases in your answer.B) HBrO2. Show the reaction with the hydronium ion as a product. Express your answer as a chemical equation. Identify all of the phases in your answer.C)C2H5COOH. Show the reaction with H+(aq) as a product. Express your answer as a chemical equation. Identify all of the phases in your answer.D) C2H5COOH. Show the reaction with the hydronium ion as a product. Express your answer as a chemical equation. Identify all of the phases in your answer.E) Write the Ka expression for ionization from the previous part.Ka=Write the expression for ionization from the previous part.[H3O+][C2H5COO][C2H5COOH][H2O][H3O+][C2H5COO]1[H3O+][C2H5COO][H3O+][C2H5COO][C2H5COOH] In Exercises 1 through 18 , determine whether the vector x is in the span V of the vectors v1,,vm (proceed "by inspection" if possible, and use the reduced row-echelon form if necessary). If x is in V, find the coordinates of x with respect to the basis B=(v1,,vm) of V, and write the coordinate vector [x]B. x=[2329];v1=[4658],v2=[6167] NEED HELP RIGHT NOW!!!4_3heartrate (caronefitness.com)Part A: (2 points each)1. Take your resting heart rate (RHR). The best time to take your RHR is in the morning before getting out of bed. To prepare, be sure to have a watch or clock that shows seconds by your bedside. Find your pulse and count the beats for one minute. Record your heart rate below. RHR:2. Following the steps outlined in Lesson 4:3 Heart Rate, find your maximum heart rate (MHR). Show your work (i.e. show the formula you used to reach your answer). MHR:3. Following the steps outlined in Lesson 4:3 Heart Rate, find your Target Heart Rate range (THR). Show your work (i.e. show the formula you used to reach your answer). THR: Part B: Now you get a chance to experiment with different exercises to see how they affect your heart rate. Try the different activities below. Except for jumping rope, you will need to do each one for at least 3 minutes. After 3 minutes, stop and check your heart rate. Be sure to warm up before beginning and allow a few minutes of rest in between each activity so your heart rate has a chance to recover before beginning a new activity. (2 points each)4. Stretching for 3 minutes Heart Rate:5. Walking at a moderate pace for 3 minutesHeart Rate:6. Bicep curl with medium to heavy resistance for 3 minutes Heart Rate:7. Lunges for 3 minutes Heart Rate: 8. Jumping Rope at a vigorous pace for 1 minute. If you dont have a jump rope, feel free to air jump, or just go through the motions of jump-roping without an actual rope. (2 points)Heart Rate:Part C: In reference to the activities you completed in Part B, answer the questions that follow. (1 point each) 9. At which activity was your heart rate the highest? 10. At which activity was your heart rate the lowest?11. During which activities were you in your target heart rate zone?12. Despite your heart rate, during which activity did you feel like you were working the hardest? The Carter Doctrine asserted that the United States would use military force to repel any nation that attempted to gain control of ______.a. the Persian Gulf regionb. NATO nationsc. the Mediterranean regiond. nations in the Western hemisphere Why in the early 2000s was there a push to prosecute more Nazis? when 1 mol of a fuel burns at constant pressure, it produces 3452 kj of heat and does 11 kj of work. what are e and h for the combustion of the fuel? trell is working in a lab testing bacteria populations. After starting out with a population of 404 bacteria, he observes the change in population and notices that the The population doubles every 36 minutes. tep 1 of 2: Find the equation for the population P in terms of time t in minutes. if a bathtub can hold 80 gallons of water. The faucet flows at the rate of 5 gallons every 3 minutes. what percentage of the tub will be filled after 12 minutes